C21H23F3N2O5S — CID 43015212
[1-(tert-butylamino)-1-oxopropan-2-yl] 4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzoate (PubChem CID 43015212) has the molecular formula C21H23F3N2O5S and a molecular weight of 472.49 g/mol. Its IUPAC name is [1-(tert-butylamino)-1-oxopropan-2-yl] 4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzoate.
| Compound Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 43015212 |
| Molecular Formula | C21H23F3N2O5S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 4-[[(2,3,4-trifluorophenyl)sulfonylamino]methyl]benzoate |
| SMILES | CC(OC(=O)c1ccc(CNS(=O)(=O)c2ccc(F)c(F)c2F)cc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H23F3N2O5S/c1-12(19(27)26-21(2,3)4)31-20(28)14-7-5-13(6-8-14)11-25-32(29,30)16-10-9-15(22)17(23)18(16)24/h5-10,12,25H,11H2,1-4H3,(H,26,27) |
| InChIKey | QJZCTUCFMLGBQA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|