C19H21IN2O2 — CID 43020407
N-(3-iodo-4-methylphenyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide (PubChem CID 43020407) has the molecular formula C19H21IN2O2 and a molecular weight of 436.29 g/mol. Its IUPAC name is N-(3-iodo-4-methylphenyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(3-iodo-4-methylphenyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 43020407 |
| Molecular Formula | C19H21IN2O2 |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | N-(3-iodo-4-methylphenyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2[nH]c3c(c2C)C(=O)CC(C)(C)C3)cc1I |
| InChI | InChI=1S/C19H21IN2O2/c1-10-5-6-12(7-13(10)20)21-18(24)17-11(2)16-14(22-17)8-19(3,4)9-15(16)23/h5-7,22H,8-9H2,1-4H3,(H,21,24) |
| InChIKey | FRFSOOOKMZRHSM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|