C22H29N3O5S — CID 24564242
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide (PubChem CID 24564242) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 24564242 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)c2[nH]c3c(c2C)C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-6-25(7-2)31(29,30)14-8-9-17(26)15(10-14)24-21(28)20-13(3)19-16(23-20)11-22(4,5)12-18(19)27/h8-10,23,26H,6-7,11-12H2,1-5H3,(H,24,28) |
| InChIKey | QHAOPIKWAUUDAC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|