C23H19N3O7 — CID 43023233
[2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate (PubChem CID 43023233) has the molecular formula C23H19N3O7 and a molecular weight of 449.42 g/mol. Its IUPAC name is [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate.
| Compound Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 43023233 |
| Molecular Formula | C23H19N3O7 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
| SMILES | CC1CC(=O)Nc2ccccc2N1C(=O)COC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C23H19N3O7/c1-14-12-21(27)24-17-4-2-3-5-18(17)25(14)22(28)13-32-23(29)20-11-10-19(33-20)15-6-8-16(9-7-15)26(30)31/h2-11,14H,12-13H2,1H3,(H,24,27) |
| InChIKey | QWHOGOUIFLAZQV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|