C18H16FN3O5 — CID 52619017
(4R)-5-[2-(2-fluoro-4-nitrophenoxy)acetyl]-4-methyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 52619017) has the molecular formula C18H16FN3O5 and a molecular weight of 373.34 g/mol. Its IUPAC name is (4R)-5-[2-(2-fluoro-4-nitrophenoxy)acetyl]-4-methyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-5-[2-(2-fluoro-4-nitrophenoxy)acetyl]-4-methyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 52619017 |
| Molecular Formula | C18H16FN3O5 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (4R)-5-[2-(2-fluoro-4-nitrophenoxy)acetyl]-4-methyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | C[C@@H]1CC(=O)Nc2ccccc2N1C(=O)COc1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C18H16FN3O5/c1-11-8-17(23)20-14-4-2-3-5-15(14)21(11)18(24)10-27-16-7-6-12(22(25)26)9-13(16)19/h2-7,9,11H,8,10H2,1H3,(H,20,23)/t11-/m1/s1 |
| InChIKey | LYVWCYFYFXHVHV-LLVKDONJSA-N |
| XLogP | 2.88 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|