C19H22N2O5 — CID 43023961
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 43023961) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 43023961 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)CN2C(=O)NC(C)(C3CC3)C2=O)c1 |
| InChI | InChI=1S/C19H22N2O5/c1-11-4-5-12(2)14(8-11)15(22)10-26-16(23)9-21-17(24)19(3,13-6-7-13)20-18(21)25/h4-5,8,13H,6-7,9-10H2,1-3H3,(H,20,25) |
| InChIKey | NYNPFRNXEFYVKS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|