C19H24N2O4 — CID 86977225
(3-methyl-5-propan-2-ylphenyl) 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 86977225) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3-methyl-5-propan-2-ylphenyl) 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | (3-methyl-5-propan-2-ylphenyl) 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 86977225 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (3-methyl-5-propan-2-ylphenyl) 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | Cc1cc(OC(=O)CN2C(=O)NC(C)(C3CC3)C2=O)cc(C(C)C)c1 |
| InChI | InChI=1S/C19H24N2O4/c1-11(2)13-7-12(3)8-15(9-13)25-16(22)10-21-17(23)19(4,14-5-6-14)20-18(21)24/h7-9,11,14H,5-6,10H2,1-4H3,(H,20,24) |
| InChIKey | AYXWAOIJJMGWCA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|