C23H18N6O3S — CID 43024020
2-[(2,4-dimethyl-5-phenylimidazo[1,5-b]pyridazin-7-yl)sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 43024020) has the molecular formula C23H18N6O3S and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-5-phenylimidazo[1,5-b]pyridazin-7-yl)sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(2,4-dimethyl-5-phenylimidazo[1,5-b]pyridazin-7-yl)sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43024020 |
| Molecular Formula | C23H18N6O3S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-[(2,4-dimethyl-5-phenylimidazo[1,5-b]pyridazin-7-yl)sulfanylmethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | Cc1cc(C)c2c(-c3ccccc3)nc(SCc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)n2n1 |
| InChI | InChI=1S/C23H18N6O3S/c1-14-12-15(2)27-28-21(14)20(16-6-4-3-5-7-16)24-23(28)33-13-19-25-26-22(32-19)17-8-10-18(11-9-17)29(30)31/h3-12H,13H2,1-2H3 |
| InChIKey | OUDSUEXHBNRUJX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 112.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|