C23H34N2O8S — CID 43028404
[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzoate (PubChem CID 43028404) has the molecular formula C23H34N2O8S and a molecular weight of 498.60 g/mol. Its IUPAC name is [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzoate.
| Compound Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzoate |
|---|---|
| PubChem CID | 43028404 |
| Molecular Formula | C23H34N2O8S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)c1ccc(OC)c(S(=O)(=O)N2CC(C)CC(C)C2)c1 |
| InChI | InChI=1S/C23H34N2O8S/c1-5-32-22(27)7-6-10-24-21(26)15-33-23(28)18-8-9-19(31-4)20(12-18)34(29,30)25-13-16(2)11-17(3)14-25/h8-9,12,16-17H,5-7,10-11,13-15H2,1-4H3,(H,24,26) |
| InChIKey | MUYTWEQISNSHON-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|