C26H28N4O5 — CID 43030900
N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentyl-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide (PubChem CID 43030900) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentyl-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentyl-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43030900 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentyl-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)N(Cc3ccc4c(c3)OCO4)C3CCCC3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H28N4O5/c1-17-25(30(32)33)18(2)29(27-17)15-19-7-10-21(11-8-19)26(31)28(22-5-3-4-6-22)14-20-9-12-23-24(13-20)35-16-34-23/h7-13,22H,3-6,14-16H2,1-2H3 |
| InChIKey | CFMACGNWNSRHLI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|