C23H17F3N4O3S — CID 43033343
N-[(E)-benzylideneamino]-2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 43033343) has the molecular formula C23H17F3N4O3S and a molecular weight of 486.48 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(E)-benzylideneamino]-2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43033343 |
| Molecular Formula | C23H17F3N4O3S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1occc1-c1nnc(SCC(=O)N(/N=C/c2ccccc2)c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C23H17F3N4O3S/c1-15-19(10-11-32-15)21-28-29-22(33-21)34-14-20(31)30(27-13-16-6-3-2-4-7-16)18-9-5-8-17(12-18)23(24,25)26/h2-13H,14H2,1H3/b27-13+ |
| InChIKey | JNRRIUYYYZDYIU-UVHMKAGCSA-N |
| XLogP | 5.82 |
| TPSA | 84.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|