C23H16F3N5O2S — CID 43033353
N-[(E)-benzylideneamino]-2-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 43033353) has the molecular formula C23H16F3N5O2S and a molecular weight of 483.48 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(E)-benzylideneamino]-2-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43033353 |
| Molecular Formula | C23H16F3N5O2S |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccnc2)o1)N(/N=C/c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H16F3N5O2S/c24-23(25,26)18-9-4-10-19(12-18)31(28-13-16-6-2-1-3-7-16)20(32)15-34-22-30-29-21(33-22)17-8-5-11-27-14-17/h1-14H,15H2/b28-13+ |
| InChIKey | ZGKDGABAKZDNGL-XODNFHPESA-N |
| XLogP | 5.31 |
| TPSA | 84.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|