C24H18F3N5OS — CID 41295270
N-[(Z)-benzylideneamino]-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 41295270) has the molecular formula C24H18F3N5OS and a molecular weight of 481.50 g/mol. Its IUPAC name is N-[(Z)-benzylideneamino]-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(Z)-benzylideneamino]-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 41295270 |
| Molecular Formula | C24H18F3N5OS |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | N-[(Z)-benzylideneamino]-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nncn1-c1ccccc1)N(/N=C\c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H18F3N5OS/c25-24(26,27)19-10-7-13-21(14-19)32(29-15-18-8-3-1-4-9-18)22(33)16-34-23-30-28-17-31(23)20-11-5-2-6-12-20/h1-15,17H,16H2/b29-15- |
| InChIKey | RFTINDDVLPXMAG-FDVSRXAVSA-N |
| XLogP | 5.45 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|