C22H17N5O7 — CID 43033455
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxylate (PubChem CID 43033455) has the molecular formula C22H17N5O7 and a molecular weight of 463.41 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxylate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxylate |
|---|---|
| PubChem CID | 43033455 |
| Molecular Formula | C22H17N5O7 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxylate |
| SMILES | CN1C(=O)c2ccccc2N2C(=O)CCC12C(=O)OCc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C22H17N5O7/c1-25-20(29)15-4-2-3-5-16(15)26-18(28)10-11-22(25,26)21(30)33-12-17-23-24-19(34-17)13-6-8-14(9-7-13)27(31)32/h2-9H,10-12H2,1H3 |
| InChIKey | LYYDDFRUDAZFCX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 148.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|