C19H25F2N3O2S — CID 43033621
6-(2,6-difluorophenyl)-3-(3-ethoxypropyl)-N,N,4-trimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 43033621) has the molecular formula C19H25F2N3O2S and a molecular weight of 397.49 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-3-(3-ethoxypropyl)-N,N,4-trimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | 6-(2,6-difluorophenyl)-3-(3-ethoxypropyl)-N,N,4-trimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 43033621 |
| Molecular Formula | C19H25F2N3O2S |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 6-(2,6-difluorophenyl)-3-(3-ethoxypropyl)-N,N,4-trimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | CCOCCCN1C(=S)NC(c2c(F)cccc2F)C(C(=O)N(C)C)=C1C |
| InChI | InChI=1S/C19H25F2N3O2S/c1-5-26-11-7-10-24-12(2)15(18(25)23(3)4)17(22-19(24)27)16-13(20)8-6-9-14(16)21/h6,8-9,17H,5,7,10-11H2,1-4H3,(H,22,27) |
| InChIKey | OKYLSGUJQGQDON-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|