C19H24F2N2O4S — CID 8947585
methyl (6S)-6-[2-(difluoromethoxy)phenyl]-3-(3-ethoxypropyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 8947585) has the molecular formula C19H24F2N2O4S and a molecular weight of 414.47 g/mol. Its IUPAC name is methyl (6S)-6-[2-(difluoromethoxy)phenyl]-3-(3-ethoxypropyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl (6S)-6-[2-(difluoromethoxy)phenyl]-3-(3-ethoxypropyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8947585 |
| Molecular Formula | C19H24F2N2O4S |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | methyl (6S)-6-[2-(difluoromethoxy)phenyl]-3-(3-ethoxypropyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOCCCN1C(=S)N[C@@H](c2ccccc2OC(F)F)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C19H24F2N2O4S/c1-4-26-11-7-10-23-12(2)15(17(24)25-3)16(22-19(23)28)13-8-5-6-9-14(13)27-18(20)21/h5-6,8-9,16,18H,4,7,10-11H2,1-3H3,(H,22,28)/t16-/m0/s1 |
| InChIKey | LYMBDMDSCUCRQE-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|