C18H23N3O6S — CID 43033606
methyl 3-(3-ethoxypropyl)-6-(4-hydroxy-3-nitrophenyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 43033606) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is methyl 3-(3-ethoxypropyl)-6-(4-hydroxy-3-nitrophenyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 3-(3-ethoxypropyl)-6-(4-hydroxy-3-nitrophenyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 43033606 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | methyl 3-(3-ethoxypropyl)-6-(4-hydroxy-3-nitrophenyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOCCCN1C(=S)NC(c2ccc(O)c([N+](=O)[O-])c2)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C18H23N3O6S/c1-4-27-9-5-8-20-11(2)15(17(23)26-3)16(19-18(20)28)12-6-7-14(22)13(10-12)21(24)25/h6-7,10,16,22H,4-5,8-9H2,1-3H3,(H,19,28) |
| InChIKey | VMXGLLJVMCTERM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|