C20H22N2O3 — CID 43034035
N-(2-anilino-2-oxoethyl)-N-(furan-2-ylmethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 43034035) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-N-(furan-2-ylmethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-N-(furan-2-ylmethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 43034035 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-N-(furan-2-ylmethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(CN(Cc1ccco1)C(=O)C1CC=CCC1)Nc1ccccc1 |
| InChI | InChI=1S/C20H22N2O3/c23-19(21-17-10-5-2-6-11-17)15-22(14-18-12-7-13-25-18)20(24)16-8-3-1-4-9-16/h1-3,5-7,10-13,16H,4,8-9,14-15H2,(H,21,23) |
| InChIKey | HGSUQRGAFOMSDT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|