C19H21NO2 — CID 75853603
N-(furan-2-ylmethyl)-N-(4-methylphenyl)cyclohex-3-ene-1-carboxamide (PubChem CID 75853603) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(4-methylphenyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(4-methylphenyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 75853603 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(4-methylphenyl)cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1ccc(N(Cc2ccco2)C(=O)C2CC=CCC2)cc1 |
| InChI | InChI=1S/C19H21NO2/c1-15-9-11-17(12-10-15)20(14-18-8-5-13-22-18)19(21)16-6-3-2-4-7-16/h2-3,5,8-13,16H,4,6-7,14H2,1H3 |
| InChIKey | RDSMUIBMJNEBKJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|