C24H26N2O4S — CID 55668767
1-(benzenesulfonyl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)piperidine-3-carboxamide (PubChem CID 55668767) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55668767 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(N(Cc2ccco2)C(=O)C2CCCN(S(=O)(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-19-11-13-21(14-12-19)26(18-22-8-6-16-30-22)24(27)20-7-5-15-25(17-20)31(28,29)23-9-3-2-4-10-23/h2-4,6,8-14,16,20H,5,7,15,17-18H2,1H3 |
| InChIKey | XCEIMLYGBADQGD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |