C18H18Cl2N2O3 — CID 42920707
N-(2-anilino-2-oxoethyl)-2,2-dichloro-N-(furan-2-ylmethyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 42920707) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-2,2-dichloro-N-(furan-2-ylmethyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-2,2-dichloro-N-(furan-2-ylmethyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 42920707 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-2,2-dichloro-N-(furan-2-ylmethyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)N(CC(=O)Nc2ccccc2)Cc2ccco2)CC1(Cl)Cl |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-17(12-18(17,19)20)16(24)22(10-14-8-5-9-25-14)11-15(23)21-13-6-3-2-4-7-13/h2-9H,10-12H2,1H3,(H,21,23) |
| InChIKey | IUMAHZSOTFOSCG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|