C19H23NO4S — CID 43034807
[2-oxo-2-(pentan-2-ylamino)ethyl] 2-(furan-2-ylmethylsulfanyl)benzoate (PubChem CID 43034807) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is [2-oxo-2-(pentan-2-ylamino)ethyl] 2-(furan-2-ylmethylsulfanyl)benzoate.
| Compound Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 2-(furan-2-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 43034807 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 2-(furan-2-ylmethylsulfanyl)benzoate |
| SMILES | CCCC(C)NC(=O)COC(=O)c1ccccc1SCc1ccco1 |
| InChI | InChI=1S/C19H23NO4S/c1-3-7-14(2)20-18(21)12-24-19(22)16-9-4-5-10-17(16)25-13-15-8-6-11-23-15/h4-6,8-11,14H,3,7,12-13H2,1-2H3,(H,20,21) |
| InChIKey | SGUZBQWJACRIIA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |