C19H23NO4S — CID 51886138
[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylsulfanyl)benzoate (PubChem CID 51886138) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylsulfanyl)benzoate.
| Compound Name | [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 51886138 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylsulfanyl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1SCc1ccco1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H23NO4S/c1-13(17(21)20-19(2,3)4)24-18(22)15-9-5-6-10-16(15)25-12-14-8-7-11-23-14/h5-11,13H,12H2,1-4H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | PZGJHFTZBBNDHS-ZDUSSCGKSA-N |
| XLogP | 4.03 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |