C24H32N2O4 — CID 43035456
2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N,4-dimethyl-N-[2-(2-methylphenoxy)ethyl]pentanamide (PubChem CID 43035456) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N,4-dimethyl-N-[2-(2-methylphenoxy)ethyl]pentanamide.
| Compound Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N,4-dimethyl-N-[2-(2-methylphenoxy)ethyl]pentanamide |
|---|---|
| PubChem CID | 43035456 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N,4-dimethyl-N-[2-(2-methylphenoxy)ethyl]pentanamide |
| SMILES | Cc1ccccc1OCCN(C)C(=O)C(CC(C)C)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C24H32N2O4/c1-16(2)15-20(26-22(27)18-10-6-7-11-19(18)23(26)28)24(29)25(4)13-14-30-21-12-8-5-9-17(21)3/h5-9,12,16,18-20H,10-11,13-15H2,1-4H3 |
| InChIKey | COTOYPRTDBVLHX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|