C19H19BrN2O4S — CID 43036959
3-[2-(4-bromophenyl)sulfonylethyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 43036959) has the molecular formula C19H19BrN2O4S and a molecular weight of 451.34 g/mol. Its IUPAC name is 3-[2-(4-bromophenyl)sulfonylethyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(4-bromophenyl)sulfonylethyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43036959 |
| Molecular Formula | C19H19BrN2O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 3-[2-(4-bromophenyl)sulfonylethyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)N(CCS(=O)(=O)c3ccc(Br)cc3)C(=O)C2C)cc1 |
| InChI | InChI=1S/C19H19BrN2O4S/c1-13-3-7-16(8-4-13)22-14(2)18(23)21(19(22)24)11-12-27(25,26)17-9-5-15(20)6-10-17/h3-10,14H,11-12H2,1-2H3 |
| InChIKey | SIZFECPDOFEADF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|