C25H26N4O5S — CID 41038112
4-[2,5-dimethyl-3-[2-[(4S)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]pyrrol-1-yl]benzenesulfonamide (PubChem CID 41038112) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is 4-[2,5-dimethyl-3-[2-[(4S)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]pyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2,5-dimethyl-3-[2-[(4S)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]pyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 41038112 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 4-[2,5-dimethyl-3-[2-[(4S)-4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]pyrrol-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(N2C(=O)N(CC(=O)c3cc(C)n(-c4ccc(S(N)(=O)=O)cc4)c3C)C(=O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C25H26N4O5S/c1-15-5-7-20(8-6-15)29-18(4)24(31)27(25(29)32)14-23(30)22-13-16(2)28(17(22)3)19-9-11-21(12-10-19)35(26,33)34/h5-13,18H,14H2,1-4H3,(H2,26,33,34)/t18-/m0/s1 |
| InChIKey | YGDSJSNSIQFEQA-SFHVURJKSA-N |
| XLogP | 3.09 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|