C19H28Cl2N2O4S — CID 43037231
2-[(3,4-dichlorophenyl)sulfonyl-(3-methoxypropyl)amino]-N-(2-methylcyclohexyl)acetamide (PubChem CID 43037231) has the molecular formula C19H28Cl2N2O4S and a molecular weight of 451.42 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)sulfonyl-(3-methoxypropyl)amino]-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-[(3,4-dichlorophenyl)sulfonyl-(3-methoxypropyl)amino]-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 43037231 |
| Molecular Formula | C19H28Cl2N2O4S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)sulfonyl-(3-methoxypropyl)amino]-N-(2-methylcyclohexyl)acetamide |
| SMILES | COCCCN(CC(=O)NC1CCCCC1C)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H28Cl2N2O4S/c1-14-6-3-4-7-18(14)22-19(24)13-23(10-5-11-27-2)28(25,26)15-8-9-16(20)17(21)12-15/h8-9,12,14,18H,3-7,10-11,13H2,1-2H3,(H,22,24) |
| InChIKey | FSFWKZWCFJHUID-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|