C20H29N3O4S — CID 7919293
2-[(4-acetamidophenyl)sulfonyl-prop-2-enylamino]-N-[(1R,2R)-2-methylcyclohexyl]acetamide (PubChem CID 7919293) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-prop-2-enylamino]-N-[(1R,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-prop-2-enylamino]-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7919293 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-prop-2-enylamino]-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
| SMILES | C=CCN(CC(=O)N[C@@H]1CCCC[C@H]1C)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C20H29N3O4S/c1-4-13-23(14-20(25)22-19-8-6-5-7-15(19)2)28(26,27)18-11-9-17(10-12-18)21-16(3)24/h4,9-12,15,19H,1,5-8,13-14H2,2-3H3,(H,21,24)(H,22,25)/t15-,19-/m1/s1 |
| InChIKey | JTLONXGQXQBARU-DNVCBOLYSA-N |
| XLogP | 2.52 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|