C25H29N3O5 — CID 43039183
N'-[3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]propanoyl]-2-(4-ethoxyphenoxy)propanehydrazide (PubChem CID 43039183) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is N'-[3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]propanoyl]-2-(4-ethoxyphenoxy)propanehydrazide.
| Compound Name | N'-[3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]propanoyl]-2-(4-ethoxyphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 43039183 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N'-[3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]propanoyl]-2-(4-ethoxyphenoxy)propanehydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)CCc2ncc(-c3ccc(C)c(C)c3)o2)cc1 |
| InChI | InChI=1S/C25H29N3O5/c1-5-31-20-8-10-21(11-9-20)32-18(4)25(30)28-27-23(29)12-13-24-26-15-22(33-24)19-7-6-16(2)17(3)14-19/h6-11,14-15,18H,5,12-13H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | CHLHMYCKZAYVPO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|