C21H20FN3O4 — CID 134011055
2-(2-fluorophenoxy)-N'-[3-(5-phenyl-1,3-oxazol-2-yl)propanoyl]propanehydrazide (PubChem CID 134011055) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N'-[3-(5-phenyl-1,3-oxazol-2-yl)propanoyl]propanehydrazide.
| Compound Name | 2-(2-fluorophenoxy)-N'-[3-(5-phenyl-1,3-oxazol-2-yl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 134011055 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-(2-fluorophenoxy)-N'-[3-(5-phenyl-1,3-oxazol-2-yl)propanoyl]propanehydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)CCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H20FN3O4/c1-14(28-17-10-6-5-9-16(17)22)21(27)25-24-19(26)11-12-20-23-13-18(29-20)15-7-3-2-4-8-15/h2-10,13-14H,11-12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | SPVCEGBEOWXYNZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|