C24H33N3O6S — CID 43039374
3-acetamido-N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-3-(4-methoxyphenyl)propanamide (PubChem CID 43039374) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is 3-acetamido-N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | 3-acetamido-N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 43039374 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 3-acetamido-N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-3-(4-methoxyphenyl)propanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CC(NC(C)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H33N3O6S/c1-6-27(7-2)34(30,31)20-13-14-23(33-8-3)22(15-20)26-24(29)16-21(25-17(4)28)18-9-11-19(32-5)12-10-18/h9-15,21H,6-8,16H2,1-5H3,(H,25,28)(H,26,29) |
| InChIKey | ROHUXQMJCPJETH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |