C20H24N4O2S2 — CID 43043916
2-[[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 43043916) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 43043916 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2nc(CC(C)C)no2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C20H24N4O2S2/c1-4-9-24-19(25)17-13-7-5-6-8-14(13)28-18(17)22-20(24)27-11-16-21-15(23-26-16)10-12(2)3/h4,12H,1,5-11H2,2-3H3 |
| InChIKey | DCOCSUQTMXOACE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|