C24H23FN6O2 — CID 43044595
1-(4-fluorophenyl)-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-4,5,6,7-tetrahydroindazole-3-carbohydrazide (PubChem CID 43044595) has the molecular formula C24H23FN6O2 and a molecular weight of 446.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-4,5,6,7-tetrahydroindazole-3-carbohydrazide.
| Compound Name | 1-(4-fluorophenyl)-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-4,5,6,7-tetrahydroindazole-3-carbohydrazide |
|---|---|
| PubChem CID | 43044595 |
| Molecular Formula | C24H23FN6O2 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-(4-fluorophenyl)-N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-4,5,6,7-tetrahydroindazole-3-carbohydrazide |
| SMILES | Cn1c(CC(=O)NNC(=O)c2nn(-c3ccc(F)cc3)c3c2CCCC3)nc2ccccc21 |
| InChI | InChI=1S/C24H23FN6O2/c1-30-20-9-5-3-7-18(20)26-21(30)14-22(32)27-28-24(33)23-17-6-2-4-8-19(17)31(29-23)16-12-10-15(25)11-13-16/h3,5,7,9-13H,2,4,6,8,14H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | IPLBVGPTIJWTND-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|