C21H24F3N3O2S — CID 43048407
1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[2-(2,2,2-trifluoroethylsulfanyl)anilino]ethanone (PubChem CID 43048407) has the molecular formula C21H24F3N3O2S and a molecular weight of 439.50 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[2-(2,2,2-trifluoroethylsulfanyl)anilino]ethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[2-(2,2,2-trifluoroethylsulfanyl)anilino]ethanone |
|---|---|
| PubChem CID | 43048407 |
| Molecular Formula | C21H24F3N3O2S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[2-(2,2,2-trifluoroethylsulfanyl)anilino]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CNc3ccccc3SCC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C21H24F3N3O2S/c1-29-17-8-6-16(7-9-17)26-10-12-27(13-11-26)20(28)14-25-18-4-2-3-5-19(18)30-15-21(22,23)24/h2-9,25H,10-15H2,1H3 |
| InChIKey | OJTOWWKEYGROFK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|