C17H14N4S — CID 43055689
4-[(3-cyanophenyl)methylsulfanyl]-2-cyclopropyl-6-methylpyrimidine-5-carbonitrile (PubChem CID 43055689) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-[(3-cyanophenyl)methylsulfanyl]-2-cyclopropyl-6-methylpyrimidine-5-carbonitrile.
| Compound Name | 4-[(3-cyanophenyl)methylsulfanyl]-2-cyclopropyl-6-methylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 43055689 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-[(3-cyanophenyl)methylsulfanyl]-2-cyclopropyl-6-methylpyrimidine-5-carbonitrile |
| SMILES | Cc1nc(C2CC2)nc(SCc2cccc(C#N)c2)c1C#N |
| InChI | InChI=1S/C17H14N4S/c1-11-15(9-19)17(21-16(20-11)14-5-6-14)22-10-13-4-2-3-12(7-13)8-18/h2-4,7,14H,5-6,10H2,1H3 |
| InChIKey | JKZJPOXZXIIZMP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |