C16H14N4OS — CID 136924180
2-[(3-cyanophenyl)methylsulfanyl]-6-oxo-4-propyl-1H-pyrimidine-5-carbonitrile (PubChem CID 136924180) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[(3-cyanophenyl)methylsulfanyl]-6-oxo-4-propyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[(3-cyanophenyl)methylsulfanyl]-6-oxo-4-propyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 136924180 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[(3-cyanophenyl)methylsulfanyl]-6-oxo-4-propyl-1H-pyrimidine-5-carbonitrile |
| SMILES | CCCc1nc(SCc2cccc(C#N)c2)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C16H14N4OS/c1-2-4-14-13(9-18)15(21)20-16(19-14)22-10-12-6-3-5-11(7-12)8-17/h3,5-7H,2,4,10H2,1H3,(H,19,20,21) |
| InChIKey | YSQFVZIAKSWXCR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|