C19H13F2N3O2S — CID 147810042
4-benzyl-2-[(3,5-difluoro-4-hydroxyphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 147810042) has the molecular formula C19H13F2N3O2S and a molecular weight of 385.40 g/mol. Its IUPAC name is 4-benzyl-2-[(3,5-difluoro-4-hydroxyphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-benzyl-2-[(3,5-difluoro-4-hydroxyphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 147810042 |
| Molecular Formula | C19H13F2N3O2S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 4-benzyl-2-[(3,5-difluoro-4-hydroxyphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(Cc2ccccc2)nc(SCc2cc(F)c(O)c(F)c2)[nH]c1=O |
| InChI | InChI=1S/C19H13F2N3O2S/c20-14-6-12(7-15(21)17(14)25)10-27-19-23-16(13(9-22)18(26)24-19)8-11-4-2-1-3-5-11/h1-7,25H,8,10H2,(H,23,24,26) |
| InChIKey | HNERSPAFCUTFPU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|