C20H17NO6S — CID 43055914
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 43055914) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 43055914 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)c2nc(-c3ccco3)sc2C)c(OC)c1 |
| InChI | InChI=1S/C20H17NO6S/c1-12-18(21-19(28-12)15-5-4-10-26-15)20(23)27-14-8-6-13(11-16(14)24-2)7-9-17(22)25-3/h4-11H,1-3H3/b9-7+ |
| InChIKey | KMIANIXXDMPBNN-VQHVLOKHSA-N |
| XLogP | 4.13 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|