C24H28N2O6S — CID 43055996
(E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[3-(oxolan-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 43055996) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is (E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[3-(oxolan-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[3-(oxolan-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 43055996 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[3-(oxolan-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C24H28N2O6S/c27-24(25-20-3-1-4-21(17-20)32-18-22-5-2-14-31-22)11-8-19-6-9-23(10-7-19)33(28,29)26-12-15-30-16-13-26/h1,3-4,6-11,17,22H,2,5,12-16,18H2,(H,25,27)/b11-8+ |
| InChIKey | PDNIESCMLGNTOX-DHZHZOJOSA-N |
| XLogP | 2.92 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|