C21H18ClFN4O3 — CID 43058431
2-[3-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-cyanoethyl)-N-(2-fluorophenyl)acetamide (PubChem CID 43058431) has the molecular formula C21H18ClFN4O3 and a molecular weight of 428.85 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-cyanoethyl)-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-cyanoethyl)-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 43058431 |
| Molecular Formula | C21H18ClFN4O3 |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-cyanoethyl)-N-(2-fluorophenyl)acetamide |
| SMILES | CC1C(=O)N(CC(=O)N(CCC#N)c2ccccc2F)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClFN4O3/c1-14-20(29)26(21(30)27(14)16-9-7-15(22)8-10-16)13-19(28)25(12-4-11-24)18-6-3-2-5-17(18)23/h2-3,5-10,14H,4,12-13H2,1H3 |
| InChIKey | UIOCZHYISMBWCZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|