C23H30ClN3O4S — CID 43058620
N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 43058620) has the molecular formula C23H30ClN3O4S and a molecular weight of 480.03 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43058620 |
| Molecular Formula | C23H30ClN3O4S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCc1ccc(C(=O)NCC(c2ccccc2Cl)N(C)C)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H30ClN3O4S/c1-4-17-9-10-18(15-22(17)32(29,30)27-11-13-31-14-12-27)23(28)25-16-21(26(2)3)19-7-5-6-8-20(19)24/h5-10,15,21H,4,11-14,16H2,1-3H3,(H,25,28) |
| InChIKey | UIFWESLKGZULLC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |