C22H29N7O4S — CID 43062207
N'-[4-(4-methylpiperazin-1-yl)sulfonylbenzoyl]-1-pyrazin-2-ylpiperidine-3-carbohydrazide (PubChem CID 43062207) has the molecular formula C22H29N7O4S and a molecular weight of 487.59 g/mol. Its IUPAC name is N'-[4-(4-methylpiperazin-1-yl)sulfonylbenzoyl]-1-pyrazin-2-ylpiperidine-3-carbohydrazide.
| Compound Name | N'-[4-(4-methylpiperazin-1-yl)sulfonylbenzoyl]-1-pyrazin-2-ylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 43062207 |
| Molecular Formula | C22H29N7O4S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N'-[4-(4-methylpiperazin-1-yl)sulfonylbenzoyl]-1-pyrazin-2-ylpiperidine-3-carbohydrazide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(C(=O)NNC(=O)C3CCCN(c4cnccn4)C3)cc2)CC1 |
| InChI | InChI=1S/C22H29N7O4S/c1-27-11-13-29(14-12-27)34(32,33)19-6-4-17(5-7-19)21(30)25-26-22(31)18-3-2-10-28(16-18)20-15-23-8-9-24-20/h4-9,15,18H,2-3,10-14,16H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | GCNSDHMCRBPNTD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|