C20H27N3O5S — CID 43066291
N'-(4-tert-butylbenzoyl)-1-(1,1-dioxothiolan-3-yl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 43066291) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is N'-(4-tert-butylbenzoyl)-1-(1,1-dioxothiolan-3-yl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | N'-(4-tert-butylbenzoyl)-1-(1,1-dioxothiolan-3-yl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 43066291 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N'-(4-tert-butylbenzoyl)-1-(1,1-dioxothiolan-3-yl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)NNC(=O)C2CC(=O)N(C3CCS(=O)(=O)C3)C2)cc1 |
| InChI | InChI=1S/C20H27N3O5S/c1-20(2,3)15-6-4-13(5-7-15)18(25)21-22-19(26)14-10-17(24)23(11-14)16-8-9-29(27,28)12-16/h4-7,14,16H,8-12H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | WSKXIKADGVTBHZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|