C24H26N4O4 — CID 43068745
3,4-dimethoxy-5-prop-2-enyl-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]benzamide (PubChem CID 43068745) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3,4-dimethoxy-5-prop-2-enyl-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-5-prop-2-enyl-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 43068745 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3,4-dimethoxy-5-prop-2-enyl-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]benzamide |
| SMILES | C=CCc1cc(C(=O)Nc2cccc(NC(=O)C(C)n3cccn3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N4O4/c1-5-8-17-13-18(14-21(31-3)22(17)32-4)24(30)27-20-10-6-9-19(15-20)26-23(29)16(2)28-12-7-11-25-28/h5-7,9-16H,1,8H2,2-4H3,(H,26,29)(H,27,30) |
| InChIKey | HRATYDUJISVQKA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|