C22H24N4O5 — CID 46427808
3,4,5-trimethoxy-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]benzamide (PubChem CID 46427808) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 46427808 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2cccc(NC(=O)C(C)n3cccn3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N4O5/c1-14(26-10-6-9-23-26)21(27)24-16-7-5-8-17(13-16)25-22(28)15-11-18(29-2)20(31-4)19(12-15)30-3/h5-14H,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | OUTLCYLIRJAGJU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |