C24H21NO4S — CID 43071417
(3Z)-3-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-1,1-dioxothiochromen-4-one (PubChem CID 43071417) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is (3Z)-3-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-1,1-dioxothiochromen-4-one.
| Compound Name | (3Z)-3-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-1,1-dioxothiochromen-4-one |
|---|---|
| PubChem CID | 43071417 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (3Z)-3-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-1,1-dioxothiochromen-4-one |
| SMILES | Cc1cc(/C=C2\CS(=O)(=O)c3ccccc3C2=O)cc(C)c1OCc1ccccn1 |
| InChI | InChI=1S/C24H21NO4S/c1-16-11-18(12-17(2)24(16)29-14-20-7-5-6-10-25-20)13-19-15-30(27,28)22-9-4-3-8-21(22)23(19)26/h3-13H,14-15H2,1-2H3/b19-13+ |
| InChIKey | NGMCJGBAYSIGNO-CPNJWEJPSA-N |
| XLogP | 4.33 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|