C28H24N2O3S — CID 134843100
(4Z)-4-[(4-phenylmethoxyphenyl)methylidene]-2-(pyridin-2-ylmethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide (PubChem CID 134843100) has the molecular formula C28H24N2O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is (4Z)-4-[(4-phenylmethoxyphenyl)methylidene]-2-(pyridin-2-ylmethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide.
| Compound Name | (4Z)-4-[(4-phenylmethoxyphenyl)methylidene]-2-(pyridin-2-ylmethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide |
|---|---|
| PubChem CID | 134843100 |
| Molecular Formula | C28H24N2O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (4Z)-4-[(4-phenylmethoxyphenyl)methylidene]-2-(pyridin-2-ylmethyl)-3H-1λ6,2-benzothiazine 1,1-dioxide |
| SMILES | O=S1(=O)c2ccccc2/C(=C/c2ccc(OCc3ccccc3)cc2)CN1Cc1ccccn1 |
| InChI | InChI=1S/C28H24N2O3S/c31-34(32)28-12-5-4-11-27(28)24(19-30(34)20-25-10-6-7-17-29-25)18-22-13-15-26(16-14-22)33-21-23-8-2-1-3-9-23/h1-18H,19-21H2/b24-18+ |
| InChIKey | RJXZHAMUEGTODX-HKOYGPOVSA-N |
| XLogP | 5.41 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|