C28H25F3N4O — CID 4307520
2-(4-benzhydrylpiperazin-1-yl)-5-[4-(trifluoromethoxy)phenyl]pyrimidine (PubChem CID 4307520) has the molecular formula C28H25F3N4O and a molecular weight of 490.53 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-5-[4-(trifluoromethoxy)phenyl]pyrimidine.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-5-[4-(trifluoromethoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 4307520 |
| Molecular Formula | C28H25F3N4O |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-5-[4-(trifluoromethoxy)phenyl]pyrimidine |
| SMILES | FC(F)(F)Oc1ccc(-c2cnc(N3CCN(C(c4ccccc4)c4ccccc4)CC3)nc2)cc1 |
| InChI | InChI=1S/C28H25F3N4O/c29-28(30,31)36-25-13-11-21(12-14-25)24-19-32-27(33-20-24)35-17-15-34(16-18-35)26(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,19-20,26H,15-18H2 |
| InChIKey | YWPLOQBPYLFMCJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |