C15H25N3O3S2 — CID 43076143
3-(2-bicyclo[2.2.1]heptanylcarbamothioylamino)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 43076143) has the molecular formula C15H25N3O3S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanylcarbamothioylamino)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanylcarbamothioylamino)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 43076143 |
| Molecular Formula | C15H25N3O3S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanylcarbamothioylamino)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | O=C(CCNC(=S)NC1CC2CCC1C2)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H25N3O3S2/c19-14(17-12-4-6-23(20,21)9-12)3-5-16-15(22)18-13-8-10-1-2-11(13)7-10/h10-13H,1-9H2,(H,17,19)(H2,16,18,22) |
| InChIKey | LIYCGTKTPHIANC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|