C15H27N3O3S2 — CID 43076138
N-(1,1-dioxothiolan-3-yl)-3-[(2-methylcyclohexyl)carbamothioylamino]propanamide (PubChem CID 43076138) has the molecular formula C15H27N3O3S2 and a molecular weight of 361.53 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[(2-methylcyclohexyl)carbamothioylamino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[(2-methylcyclohexyl)carbamothioylamino]propanamide |
|---|---|
| PubChem CID | 43076138 |
| Molecular Formula | C15H27N3O3S2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[(2-methylcyclohexyl)carbamothioylamino]propanamide |
| SMILES | CC1CCCCC1NC(=S)NCCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H27N3O3S2/c1-11-4-2-3-5-13(11)18-15(22)16-8-6-14(19)17-12-7-9-23(20,21)10-12/h11-13H,2-10H2,1H3,(H,17,19)(H2,16,18,22) |
| InChIKey | FROMGDAADIDAQU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|